C17H23ClN4O2 — CID 137028897
N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 137028897) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 137028897 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CCc1cc(=O)[nH]c(-c2cccc(NC(=O)CCCNC)c2)n1.Cl |
| InChI | InChI=1S/C17H22N4O2.ClH/c1-3-13-11-16(23)21-17(20-13)12-6-4-7-14(10-12)19-15(22)8-5-9-18-2;/h4,6-7,10-11,18H,3,5,8-9H2,1-2H3,(H,19,22)(H,20,21,23);1H |
| InChIKey | AXCZIZYXSQEHCN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|