C17H22N4O3 — CID 137045988
4-amino-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-3-methoxybutanamide (PubChem CID 137045988) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-amino-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 137045988 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-amino-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-3-methoxybutanamide |
| SMILES | CCc1cc(=O)[nH]c(-c2cccc(NC(=O)CC(CN)OC)c2)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-12-8-15(22)21-17(20-12)11-5-4-6-13(7-11)19-16(23)9-14(10-18)24-2/h4-8,14H,3,9-10,18H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | ALRJAHKDCDPBBP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |