C19H19N3O4 — CID 137029125
1-(1,4-dioxan-2-ylmethyl)-2-(5-methyl-6-oxo-1H-pyridin-3-yl)benzimidazole-5-carbaldehyde (PubChem CID 137029125) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-2-(5-methyl-6-oxo-1H-pyridin-3-yl)benzimidazole-5-carbaldehyde.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-2-(5-methyl-6-oxo-1H-pyridin-3-yl)benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 137029125 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-2-(5-methyl-6-oxo-1H-pyridin-3-yl)benzimidazole-5-carbaldehyde |
| SMILES | Cc1cc(-c2nc3cc(C=O)ccc3n2CC2COCCO2)c[nH]c1=O |
| InChI | InChI=1S/C19H19N3O4/c1-12-6-14(8-20-19(12)24)18-21-16-7-13(10-23)2-3-17(16)22(18)9-15-11-25-4-5-26-15/h2-3,6-8,10,15H,4-5,9,11H2,1H3,(H,20,24) |
| InChIKey | BFQHPTOZDHITTN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|