C17H20N6OS — CID 137029577
2-[6-amino-5-[2-(1,3-thiazol-2-ylamino)butylamino]pyridazin-3-yl]phenol (PubChem CID 137029577) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[6-amino-5-[2-(1,3-thiazol-2-ylamino)butylamino]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[2-(1,3-thiazol-2-ylamino)butylamino]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029577 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[6-amino-5-[2-(1,3-thiazol-2-ylamino)butylamino]pyridazin-3-yl]phenol |
| SMILES | CCC(CNc1cc(-c2ccccc2O)nnc1N)Nc1nccs1 |
| InChI | InChI=1S/C17H20N6OS/c1-2-11(21-17-19-7-8-25-17)10-20-14-9-13(22-23-16(14)18)12-5-3-4-6-15(12)24/h3-9,11,24H,2,10H2,1H3,(H2,18,23)(H,19,21)(H,20,22) |
| InChIKey | JTBGQUYSMZBWBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |