C13H22N4O — CID 137030179
4-(2,6-dimethylheptan-4-yldiazenyl)-1H-pyrimidin-6-one (PubChem CID 137030179) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-(2,6-dimethylheptan-4-yldiazenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,6-dimethylheptan-4-yldiazenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137030179 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-(2,6-dimethylheptan-4-yldiazenyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)CC(CC(C)C)/N=N/c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C13H22N4O/c1-9(2)5-11(6-10(3)4)16-17-12-7-13(18)15-8-14-12/h7-11H,5-6H2,1-4H3,(H,14,15,18)/b17-16+ |
| InChIKey | HYDAXZSUNGYZQN-WUKNDPDISA-N |
| XLogP | 3.31 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|