C11H19N3O — CID 136956718
4-(4-methylhexan-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 136956718) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(4-methylhexan-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(4-methylhexan-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956718 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-(4-methylhexan-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CCC(C)CC(C)Nc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C11H19N3O/c1-4-8(2)5-9(3)14-10-6-11(15)13-7-12-10/h6-9H,4-5H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | AMKGCYHGWXIVJH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |