C11H14ClIN4O — CID 137031633
1-[5-(4-iodo-1H-pyrrol-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 137031633) has the molecular formula C11H14ClIN4O and a molecular weight of 380.62 g/mol. Its IUPAC name is 1-[5-(4-iodo-1H-pyrrol-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-(4-iodo-1H-pyrrol-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 137031633 |
| Molecular Formula | C11H14ClIN4O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1-[5-(4-iodo-1H-pyrrol-2-yl)-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2noc(-c3cc(I)c[nH]3)n2)CCCC1 |
| InChI | InChI=1S/C11H13IN4O.ClH/c12-7-5-8(14-6-7)9-15-10(16-17-9)11(13)3-1-2-4-11;/h5-6,14H,1-4,13H2;1H |
| InChIKey | RUTKRWPPKNZRNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|