C25H26F2N6O3 — CID 137036954
2-(2,6-difluorophenyl)-6-(3,5-dimethoxy-2-methylhexa-2,4-dienyl)-4-[(1-methylpyrazol-4-yl)amino]pyrrolo[3,4-d]pyrimidin-5-ol (PubChem CID 137036954) has the molecular formula C25H26F2N6O3 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-(3,5-dimethoxy-2-methylhexa-2,4-dienyl)-4-[(1-methylpyrazol-4-yl)amino]pyrrolo[3,4-d]pyrimidin-5-ol.
| Compound Name | 2-(2,6-difluorophenyl)-6-(3,5-dimethoxy-2-methylhexa-2,4-dienyl)-4-[(1-methylpyrazol-4-yl)amino]pyrrolo[3,4-d]pyrimidin-5-ol |
|---|---|
| PubChem CID | 137036954 |
| Molecular Formula | C25H26F2N6O3 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-(3,5-dimethoxy-2-methylhexa-2,4-dienyl)-4-[(1-methylpyrazol-4-yl)amino]pyrrolo[3,4-d]pyrimidin-5-ol |
| SMILES | COC(C)=CC(OC)=C(C)Cn1cc2nc(-c3c(F)cccc3F)nc(Nc3cnn(C)c3)c2c1O |
| InChI | InChI=1S/C25H26F2N6O3/c1-14(20(36-5)9-15(2)35-4)11-33-13-19-22(25(33)34)24(29-16-10-28-32(3)12-16)31-23(30-19)21-17(26)7-6-8-18(21)27/h6-10,12-13,34H,11H2,1-5H3,(H,29,30,31) |
| InChIKey | GSADBSMHTKKAKD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|