C20H10ClF5N6O2 — CID 137037060
3-(2-chloro-6-fluorophenyl)-N-diazenyl-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carboxamide (PubChem CID 137037060) has the molecular formula C20H10ClF5N6O2 and a molecular weight of 496.78 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-diazenyl-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-diazenyl-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 137037060 |
| Molecular Formula | C20H10ClF5N6O2 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-diazenyl-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carboxamide |
| SMILES | [H]/N=N/NC(=O)c1c(-c2c(F)cccc2Cl)noc1-c1cnn(-c2cccc(F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C20H10ClF5N6O2/c21-12-5-2-6-13(23)14(12)16-15(19(33)29-31-27)17(34-30-16)11-8-28-32(18(11)20(24,25)26)10-4-1-3-9(22)7-10/h1-8H,(H2,27,29,33) |
| InChIKey | ZYARRWUJPNMTDQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|