C20H9ClF5N3O2S — CID 88850164
3-(2-chloro-6-fluorophenyl)-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carbothioic S-acid (PubChem CID 88850164) has the molecular formula C20H9ClF5N3O2S and a molecular weight of 485.82 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carbothioic S-acid.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carbothioic S-acid |
|---|---|
| PubChem CID | 88850164 |
| Molecular Formula | C20H9ClF5N3O2S |
| Molecular Weight | 485.82 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-[1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-1,2-oxazole-4-carbothioic S-acid |
| SMILES | O=C(S)c1c(-c2c(F)cccc2Cl)noc1-c1cnn(-c2cccc(F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C20H9ClF5N3O2S/c21-12-5-2-6-13(23)14(12)16-15(19(30)32)17(31-28-16)11-8-27-29(18(11)20(24,25)26)10-4-1-3-9(22)7-10/h1-8H,(H,30,32) |
| InChIKey | CZNDJJIEZKZDDO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 60.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.82 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|