C18H18N2O4 — CID 137037352
2-hydroxy-1-[2-hydroxy-5-[[(4-hydroxy-3,5-dimethylphenyl)methylidenehydrazinylidene]methyl]phenyl]ethanone (PubChem CID 137037352) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-hydroxy-1-[2-hydroxy-5-[[(4-hydroxy-3,5-dimethylphenyl)methylidenehydrazinylidene]methyl]phenyl]ethanone.
| Compound Name | 2-hydroxy-1-[2-hydroxy-5-[[(4-hydroxy-3,5-dimethylphenyl)methylidenehydrazinylidene]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 137037352 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-hydroxy-1-[2-hydroxy-5-[[(4-hydroxy-3,5-dimethylphenyl)methylidenehydrazinylidene]methyl]phenyl]ethanone |
| SMILES | Cc1cc(C=NN=Cc2ccc(O)c(C(=O)CO)c2)cc(C)c1O |
| InChI | InChI=1S/C18H18N2O4/c1-11-5-14(6-12(2)18(11)24)9-20-19-8-13-3-4-16(22)15(7-13)17(23)10-21/h3-9,21-22,24H,10H2,1-2H3 |
| InChIKey | VHDPALXEEYIOGG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|