C20H14N4S — CID 137040736
2-(5-pyridin-2-yl-1H-pyrazol-3-yl)-4-thiophen-3-yl-1H-indole (PubChem CID 137040736) has the molecular formula C20H14N4S and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-(5-pyridin-2-yl-1H-pyrazol-3-yl)-4-thiophen-3-yl-1H-indole.
| Compound Name | 2-(5-pyridin-2-yl-1H-pyrazol-3-yl)-4-thiophen-3-yl-1H-indole |
|---|---|
| PubChem CID | 137040736 |
| Molecular Formula | C20H14N4S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(5-pyridin-2-yl-1H-pyrazol-3-yl)-4-thiophen-3-yl-1H-indole |
| SMILES | c1ccc(-c2cc(-c3cc4c(-c5ccsc5)cccc4[nH]3)n[nH]2)nc1 |
| InChI | InChI=1S/C20H14N4S/c1-2-8-21-17(5-1)19-11-20(24-23-19)18-10-15-14(13-7-9-25-12-13)4-3-6-16(15)22-18/h1-12,22H,(H,23,24) |
| InChIKey | LHFTVTJEKJYQSI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |