C31H21N5OS — CID 137115245
N-[5-[3-(4-thiophen-3-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]benzamide (PubChem CID 137115245) has the molecular formula C31H21N5OS and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[5-[3-(4-thiophen-3-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]benzamide.
| Compound Name | N-[5-[3-(4-thiophen-3-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 137115245 |
| Molecular Formula | C31H21N5OS |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[5-[3-(4-thiophen-3-yl-1H-indol-2-yl)-1H-indazol-5-yl]-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1cncc(-c2ccc3[nH]nc(-c4cc5c(-c6ccsc6)cccc5[nH]4)c3c2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H21N5OS/c37-31(19-5-2-1-3-6-19)33-23-13-22(16-32-17-23)20-9-10-28-26(14-20)30(36-35-28)29-15-25-24(21-11-12-38-18-21)7-4-8-27(25)34-29/h1-18,34H,(H,33,37)(H,35,36) |
| InChIKey | GMKYOQMMOFNWJG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |