C28H24Cl2N2O2S — CID 137044011
(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137044011) has the molecular formula C28H24Cl2N2O2S and a molecular weight of 523.49 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044011 |
| Molecular Formula | C28H24Cl2N2O2S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-prop-2-enylphenyl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\S/C(=N/c3ccc(CC)cc3)NC2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H24Cl2N2O2S/c1-3-5-20-14-19(8-13-25(20)34-17-21-9-10-22(29)16-24(21)30)15-26-27(33)32-28(35-26)31-23-11-6-18(4-2)7-12-23/h3,6-16H,1,4-5,17H2,2H3,(H,31,32,33)/b26-15- |
| InChIKey | TXERGNKICIVEEJ-YSMPRRRNSA-N |
| XLogP | 7.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|