C26H28N2O4 — CID 137045527
3-hydroxy-4-(4-hydroxyphenyl)-1-(4-octoxyphenyl)-2H-pyrrolo[3,4-c]pyrrol-6-one (PubChem CID 137045527) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-hydroxy-4-(4-hydroxyphenyl)-1-(4-octoxyphenyl)-2H-pyrrolo[3,4-c]pyrrol-6-one.
| Compound Name | 3-hydroxy-4-(4-hydroxyphenyl)-1-(4-octoxyphenyl)-2H-pyrrolo[3,4-c]pyrrol-6-one |
|---|---|
| PubChem CID | 137045527 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-hydroxy-4-(4-hydroxyphenyl)-1-(4-octoxyphenyl)-2H-pyrrolo[3,4-c]pyrrol-6-one |
| SMILES | CCCCCCCCOc1ccc(-c2[nH]c(O)c3c2C(=O)N=C3c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-2-3-4-5-6-7-16-32-20-14-10-18(11-15-20)24-22-21(25(30)28-24)23(27-26(22)31)17-8-12-19(29)13-9-17/h8-15,28-30H,2-7,16H2,1H3 |
| InChIKey | YRDLPAXJTJXONW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|