C30H30N4O2 — CID 137046457
3-[N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-C-phenylcarbonimidoyl]-N-benzyl-2-hydroxy-1H-indole-5-carboxamide (PubChem CID 137046457) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-C-phenylcarbonimidoyl]-N-benzyl-2-hydroxy-1H-indole-5-carboxamide.
| Compound Name | 3-[N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-C-phenylcarbonimidoyl]-N-benzyl-2-hydroxy-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 137046457 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-[N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-C-phenylcarbonimidoyl]-N-benzyl-2-hydroxy-1H-indole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2[nH]c(O)c(/C(=N/[C@H]3CN4CCC3CC4)c3ccccc3)c2c1 |
| InChI | InChI=1S/C30H30N4O2/c35-29(31-18-20-7-3-1-4-8-20)23-11-12-25-24(17-23)27(30(36)33-25)28(22-9-5-2-6-10-22)32-26-19-34-15-13-21(26)14-16-34/h1-12,17,21,26,33,36H,13-16,18-19H2,(H,31,35)/b32-28+/t26-/m0/s1 |
| InChIKey | SNBQVNFMJPCCNW-DCQGRGEYSA-N |
| XLogP | 4.74 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|