C23H17Cl2N3O3 — CID 52912342
2-(4-amino-3,5-dichlorophenyl)-N-benzyl-3-hydroxy-4-oxo-1H-quinoline-6-carboxamide (PubChem CID 52912342) has the molecular formula C23H17Cl2N3O3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-N-benzyl-3-hydroxy-4-oxo-1H-quinoline-6-carboxamide.
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-N-benzyl-3-hydroxy-4-oxo-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 52912342 |
| Molecular Formula | C23H17Cl2N3O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-N-benzyl-3-hydroxy-4-oxo-1H-quinoline-6-carboxamide |
| SMILES | Nc1c(Cl)cc(-c2[nH]c3ccc(C(=O)NCc4ccccc4)cc3c(=O)c2O)cc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O3/c24-16-9-14(10-17(25)19(16)26)20-22(30)21(29)15-8-13(6-7-18(15)28-20)23(31)27-11-12-4-2-1-3-5-12/h1-10,30H,11,26H2,(H,27,31)(H,28,29) |
| InChIKey | GDYMBUSXUUKJJQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|