C17H18N4O2 — CID 66831579
3-(2-aminoethyl)-N-benzyl-2-oxo-1H-benzimidazole-5-carboxamide (PubChem CID 66831579) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N-benzyl-2-oxo-1H-benzimidazole-5-carboxamide.
| Compound Name | 3-(2-aminoethyl)-N-benzyl-2-oxo-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 66831579 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-(2-aminoethyl)-N-benzyl-2-oxo-1H-benzimidazole-5-carboxamide |
| SMILES | NCCn1c(=O)[nH]c2ccc(C(=O)NCc3ccccc3)cc21 |
| InChI | InChI=1S/C17H18N4O2/c18-8-9-21-15-10-13(6-7-14(15)20-17(21)23)16(22)19-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11,18H2,(H,19,22)(H,20,23) |
| InChIKey | KXMUNEBHQFEAGP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |