C19H22N4O4 — CID 140579042
3-(2-aminoethyl)-N-(3,3-dihydroxy-2-phenylpropyl)-2-oxo-1H-benzimidazole-5-carboxamide (PubChem CID 140579042) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N-(3,3-dihydroxy-2-phenylpropyl)-2-oxo-1H-benzimidazole-5-carboxamide.
| Compound Name | 3-(2-aminoethyl)-N-(3,3-dihydroxy-2-phenylpropyl)-2-oxo-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 140579042 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(2-aminoethyl)-N-(3,3-dihydroxy-2-phenylpropyl)-2-oxo-1H-benzimidazole-5-carboxamide |
| SMILES | NCCn1c(=O)[nH]c2ccc(C(=O)NCC(c3ccccc3)C(O)O)cc21 |
| InChI | InChI=1S/C19H22N4O4/c20-8-9-23-16-10-13(6-7-15(16)22-19(23)27)17(24)21-11-14(18(25)26)12-4-2-1-3-5-12/h1-7,10,14,18,25-26H,8-9,11,20H2,(H,21,24)(H,22,27) |
| InChIKey | MLMBBGYJDKYKDE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|