C14H20N4O2 — CID 66831509
3-(2-aminoethyl)-N,N-diethyl-2-oxo-1H-benzimidazole-5-carboxamide (PubChem CID 66831509) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N,N-diethyl-2-oxo-1H-benzimidazole-5-carboxamide.
| Compound Name | 3-(2-aminoethyl)-N,N-diethyl-2-oxo-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 66831509 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(2-aminoethyl)-N,N-diethyl-2-oxo-1H-benzimidazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2[nH]c(=O)n(CCN)c2c1 |
| InChI | InChI=1S/C14H20N4O2/c1-3-17(4-2)13(19)10-5-6-11-12(9-10)18(8-7-15)14(20)16-11/h5-6,9H,3-4,7-8,15H2,1-2H3,(H,16,20) |
| InChIKey | UWIFMNMYVTWIFK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |