C21H21Cl2N3O3 — CID 52912586
2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-4-oxo-N-pentyl-1H-quinoline-8-carboxamide (PubChem CID 52912586) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-4-oxo-N-pentyl-1H-quinoline-8-carboxamide.
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-4-oxo-N-pentyl-1H-quinoline-8-carboxamide |
|---|---|
| PubChem CID | 52912586 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-4-oxo-N-pentyl-1H-quinoline-8-carboxamide |
| SMILES | CCCCCNC(=O)c1cccc2c(=O)c(O)c(-c3cc(Cl)c(N)c(Cl)c3)[nH]c12 |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-2-3-4-8-25-21(29)13-7-5-6-12-18(13)26-17(20(28)19(12)27)11-9-14(22)16(24)15(23)10-11/h5-7,9-10,28H,2-4,8,24H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | ZMWAXPDPQLLBBR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|