C24H27Cl2N3O3 — CID 52912386
2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-octyl-4-oxo-1H-quinoline-6-carboxamide (PubChem CID 52912386) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-octyl-4-oxo-1H-quinoline-6-carboxamide.
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-octyl-4-oxo-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 52912386 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-octyl-4-oxo-1H-quinoline-6-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1ccc2[nH]c(-c3cc(Cl)c(N)c(Cl)c3)c(O)c(=O)c2c1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-2-3-4-5-6-7-10-28-24(32)14-8-9-19-16(11-14)22(30)23(31)21(29-19)15-12-17(25)20(27)18(26)13-15/h8-9,11-13,31H,2-7,10,27H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | CSEVVUQIEACLLL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|