C22H19Cl2N5O3 — CID 52912494
2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-4-oxo-1H-quinoline-8-carboxamide (PubChem CID 52912494) has the molecular formula C22H19Cl2N5O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-4-oxo-1H-quinoline-8-carboxamide.
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-4-oxo-1H-quinoline-8-carboxamide |
|---|---|
| PubChem CID | 52912494 |
| Molecular Formula | C22H19Cl2N5O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-4-oxo-1H-quinoline-8-carboxamide |
| SMILES | Nc1c(Cl)cc(-c2[nH]c3c(C(=O)NCCCn4ccnc4)cccc3c(=O)c2O)cc1Cl |
| InChI | InChI=1S/C22H19Cl2N5O3/c23-15-9-12(10-16(24)17(15)25)18-21(31)20(30)13-3-1-4-14(19(13)28-18)22(32)27-5-2-7-29-8-6-26-11-29/h1,3-4,6,8-11,31H,2,5,7,25H2,(H,27,32)(H,28,30) |
| InChIKey | XVPLQVYPJDRRNJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|