C25H22N2O3 — CID 16745860
3-hydroxy-2-(4-methylphenyl)-N-[(4-methylphenyl)methyl]-4-oxo-1H-quinoline-7-carboxamide (PubChem CID 16745860) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-hydroxy-2-(4-methylphenyl)-N-[(4-methylphenyl)methyl]-4-oxo-1H-quinoline-7-carboxamide.
| Compound Name | 3-hydroxy-2-(4-methylphenyl)-N-[(4-methylphenyl)methyl]-4-oxo-1H-quinoline-7-carboxamide |
|---|---|
| PubChem CID | 16745860 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-hydroxy-2-(4-methylphenyl)-N-[(4-methylphenyl)methyl]-4-oxo-1H-quinoline-7-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3c(=O)c(O)c(-c4ccc(C)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-15-3-7-17(8-4-15)14-26-25(30)19-11-12-20-21(13-19)27-22(24(29)23(20)28)18-9-5-16(2)6-10-18/h3-13,29H,14H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | SKXWAJCAKXURHC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |