C25H19N3O — CID 134144670
N-[(4-pyridin-4-ylphenyl)methyl]-9H-carbazole-2-carboxamide (PubChem CID 134144670) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[(4-pyridin-4-ylphenyl)methyl]-9H-carbazole-2-carboxamide.
| Compound Name | N-[(4-pyridin-4-ylphenyl)methyl]-9H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 134144670 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[(4-pyridin-4-ylphenyl)methyl]-9H-carbazole-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2ccncc2)cc1)c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C25H19N3O/c29-25(20-9-10-22-21-3-1-2-4-23(21)28-24(22)15-20)27-16-17-5-7-18(8-6-17)19-11-13-26-14-12-19/h1-15,28H,16H2,(H,27,29) |
| InChIKey | CFOSETDQZJUDSC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |