C23H24N2O4 — CID 142337828
ethyl 3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzoate;methanol (PubChem CID 142337828) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzoate;methanol.
| Compound Name | ethyl 3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzoate;methanol |
|---|---|
| PubChem CID | 142337828 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethyl 3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzoate;methanol |
| SMILES | CCOC(=O)c1cccc(CNC(=O)c2ccc(-c3ccncc3)cc2)c1.CO |
| InChI | InChI=1S/C22H20N2O3.CH4O/c1-2-27-22(26)20-5-3-4-16(14-20)15-24-21(25)19-8-6-17(7-9-19)18-10-12-23-13-11-18;1-2/h3-14H,2,15H2,1H3,(H,24,25);2H,1H3 |
| InChIKey | ZUJOLNYEGXKRSU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |