C15H20N2O5 — CID 67258110
ethyl 3-[[(2-ethoxy-2-oxoethyl)carbamoylamino]methyl]benzoate (PubChem CID 67258110) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 3-[[(2-ethoxy-2-oxoethyl)carbamoylamino]methyl]benzoate.
| Compound Name | ethyl 3-[[(2-ethoxy-2-oxoethyl)carbamoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 67258110 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 3-[[(2-ethoxy-2-oxoethyl)carbamoylamino]methyl]benzoate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C15H20N2O5/c1-3-21-13(18)10-17-15(20)16-9-11-6-5-7-12(8-11)14(19)22-4-2/h5-8H,3-4,9-10H2,1-2H3,(H2,16,17,20) |
| InChIKey | BSELAWGUAOXFOD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |