C19H21F3N6O3 — CID 137049325
2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049325) has the molecular formula C19H21F3N6O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049325 |
| Molecular Formula | C19H21F3N6O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[5-methyl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCC(C(C)(O)C(F)(F)F)CC2)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H21F3N6O3/c1-11-13(10-23-28(11)17-24-15(29)14-4-3-7-27(14)25-17)16(30)26-8-5-12(6-9-26)18(2,31)19(20,21)22/h3-4,7,10,12,31H,5-6,8-9H2,1-2H3,(H,24,25,29) |
| InChIKey | CNYGQWRJIVBBBN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |