About (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide
(2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide (PubChem CID 137052917) has the molecular formula C12H20N4O4S
and a molecular weight of 316.38 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide |
| PubChem CID | 137052917 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCO[C@@H](CCc2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C12H20N4O4S/c1-15(2)21(18,19)16-5-6-20-11(8-16)4-3-10-7-12(17)14-9-13-10/h7,9,11H,3-6,8H2,1-2H3,(H,13,14,17)/t11-/m0/s1 |
| InChIKey | NOMVJJMAHYFNRN-NSHDSACASA-N |
| XLogP | -0.79 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide?
The IUPAC name of (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide (CID 137052917) is (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide.
What is the SMILES notation for (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide?
The canonical SMILES for (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide is CN(C)S(=O)(=O)N1CCO[C@@H](CCc2cc(=O)[nH]cn2)C1.
What is the InChIKey of (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide?
The InChIKey is NOMVJJMAHYFNRN-NSHDSACASA-N. The full InChI is InChI=1S/C12H20N4O4S/c1-15(2)21(18,19)16-5-6-20-11(8-16)4-3-10-7-12(17)14-9-13-10/h7,9,11H,3-6,8H2,1-2H3,(H,13,14,17)/t11-/m0/s1.
What are the key properties of (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide?
(2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide has a molecular weight of 316.38 g/mol, XLogP of -0.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethyl-2-[2-(6-oxo-1H-pyrimidin-4-yl)ethyl]morpholine-4-sulfonamide is sourced from PubChem (CID 137052917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).