C14H17N5O2 — CID 137145707
4-[2-[(2S)-4-pyrazin-2-ylmorpholin-2-yl]ethyl]-1H-pyrimidin-6-one (PubChem CID 137145707) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[2-[(2S)-4-pyrazin-2-ylmorpholin-2-yl]ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[2-[(2S)-4-pyrazin-2-ylmorpholin-2-yl]ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137145707 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-[2-[(2S)-4-pyrazin-2-ylmorpholin-2-yl]ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(CC[C@H]2CN(c3cnccn3)CCO2)nc[nH]1 |
| InChI | InChI=1S/C14H17N5O2/c20-14-7-11(17-10-18-14)1-2-12-9-19(5-6-21-12)13-8-15-3-4-16-13/h3-4,7-8,10,12H,1-2,5-6,9H2,(H,17,18,20)/t12-/m0/s1 |
| InChIKey | LYWGLAVXNGHFCJ-LBPRGKRZSA-N |
| XLogP | 0.40 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |