C31H33F3N6O7 — CID 137058063
2-[3-[2-(4-carbamimidoylphenyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]ethyl]-5-oxo-4H-1,2,4-triazol-1-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 137058063) has the molecular formula C31H33F3N6O7 and a molecular weight of 658.63 g/mol. Its IUPAC name is 2-[3-[2-(4-carbamimidoylphenyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]ethyl]-5-oxo-4H-1,2,4-triazol-1-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[2-(4-carbamimidoylphenyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]ethyl]-5-oxo-4H-1,2,4-triazol-1-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137058063 |
| Molecular Formula | C31H33F3N6O7 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | 2-[3-[2-(4-carbamimidoylphenyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]ethyl]-5-oxo-4H-1,2,4-triazol-1-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(c2ccc(OCCOC)c(OCC)c2)c2nn(-c3ccccc3C(N)=O)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C29H32N6O5.C2HF3O2/c1-3-39-25-17-20(12-13-24(25)40-15-14-38-2)22(16-18-8-10-19(11-9-18)26(30)31)28-33-29(37)35(34-28)23-7-5-4-6-21(23)27(32)36;3-2(4,5)1(6)7/h4-13,17,22H,3,14-16H2,1-2H3,(H3,30,31)(H2,32,36)(H,33,34,37);(H,6,7) |
| InChIKey | MDORSGBKSQVQFC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 208.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|