C28H30F3N7O5 — CID 137158435
4-[2-[3-ethyl-5-(2-methoxyethoxy)phenyl]-2-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 137158435) has the molecular formula C28H30F3N7O5 and a molecular weight of 601.59 g/mol. Its IUPAC name is 4-[2-[3-ethyl-5-(2-methoxyethoxy)phenyl]-2-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[3-ethyl-5-(2-methoxyethoxy)phenyl]-2-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137158435 |
| Molecular Formula | C28H30F3N7O5 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 4-[2-[3-ethyl-5-(2-methoxyethoxy)phenyl]-2-(5-oxo-1-pyrimidin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(c2cc(CC)cc(OCCOC)c2)c2nn(-c3ncccn3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H29N7O3.C2HF3O2/c1-3-17-13-20(16-21(14-17)36-12-11-35-2)22(15-18-5-7-19(8-6-18)23(27)28)24-31-26(34)33(32-24)25-29-9-4-10-30-25;3-2(4,5)1(6)7/h4-10,13-14,16,22H,3,11-12,15H2,1-2H3,(H3,27,28)(H,31,32,34);(H,6,7) |
| InChIKey | MVVGDYUXGNVZQR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|