C33H36F7N7O6 — CID 158879901
4-[2-[3-[2-(dimethylamino)propoxy]-5-ethyl-2-fluorophenyl]-2-(5-oxo-1-pyridin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 158879901) has the molecular formula C33H36F7N7O6 and a molecular weight of 759.68 g/mol. Its IUPAC name is 4-[2-[3-[2-(dimethylamino)propoxy]-5-ethyl-2-fluorophenyl]-2-(5-oxo-1-pyridin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[2-[3-[2-(dimethylamino)propoxy]-5-ethyl-2-fluorophenyl]-2-(5-oxo-1-pyridin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 158879901 |
| Molecular Formula | C33H36F7N7O6 |
| Molecular Weight | 759.68 g/mol |
| Exact Mass | 759.26 |
| IUPAC Name | 4-[2-[3-[2-(dimethylamino)propoxy]-5-ethyl-2-fluorophenyl]-2-(5-oxo-1-pyridin-2-yl-4H-1,2,4-triazol-3-yl)ethyl]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(c2nn(-c3ccccn3)c(=O)[nH]2)c2cc(CC)cc(OCC(C)N(C)C)c2F)cc1 |
| InChI | InChI=1S/C29H34FN7O2.2C2HF3O2/c1-5-19-14-22(26(30)24(16-19)39-17-18(2)36(3)4)23(15-20-9-11-21(12-10-20)27(31)32)28-34-29(38)37(35-28)25-8-6-7-13-33-25;2*3-2(4,5)1(6)7/h6-14,16,18,23H,5,15,17H2,1-4H3,(H3,31,32)(H,34,35,38);2*(H,6,7) |
| InChIKey | YKWSGDKUJHZGHC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 200.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|