C19H17BrN4O2S — CID 137058399
N-(3-bromophenyl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 137058399) has the molecular formula C19H17BrN4O2S and a molecular weight of 445.34 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 137058399 |
| Molecular Formula | C19H17BrN4O2S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-(3-bromophenyl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(Br)c2)nnc1-c1ccccc1O |
| InChI | InChI=1S/C19H17BrN4O2S/c1-2-10-24-18(15-8-3-4-9-16(15)25)22-23-19(24)27-12-17(26)21-14-7-5-6-13(20)11-14/h2-9,11,25H,1,10,12H2,(H,21,26) |
| InChIKey | GRYFBKGLMBULMO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|