C20H16ClN4O3S- — CID 2205936
3-[[2-[[5-(2-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 2205936) has the molecular formula C20H16ClN4O3S- and a molecular weight of 427.89 g/mol. Its IUPAC name is 3-[[2-[[5-(2-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | 3-[[2-[[5-(2-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2205936 |
| Molecular Formula | C20H16ClN4O3S- |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-[[2-[[5-(2-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(C(=O)[O-])c2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN4O3S/c1-2-10-25-18(15-8-3-4-9-16(15)21)23-24-20(25)29-12-17(26)22-14-7-5-6-13(11-14)19(27)28/h2-9,11H,1,10,12H2,(H,22,26)(H,27,28)/p-1 |
| InChIKey | SUVYYQSPHNMMMR-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|