C18H15Cl2N5O4S — CID 137058693
N-(2,6-dichloro-4-nitrophenyl)-2-[[4-ethyl-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 137058693) has the molecular formula C18H15Cl2N5O4S and a molecular weight of 468.32 g/mol. Its IUPAC name is N-(2,6-dichloro-4-nitrophenyl)-2-[[4-ethyl-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,6-dichloro-4-nitrophenyl)-2-[[4-ethyl-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 137058693 |
| Molecular Formula | C18H15Cl2N5O4S |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | N-(2,6-dichloro-4-nitrophenyl)-2-[[4-ethyl-5-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)nnc1-c1ccccc1O |
| InChI | InChI=1S/C18H15Cl2N5O4S/c1-2-24-17(11-5-3-4-6-14(11)26)22-23-18(24)30-9-15(27)21-16-12(19)7-10(25(28)29)8-13(16)20/h3-8,26H,2,9H2,1H3,(H,21,27) |
| InChIKey | RLLFKXREXWFMBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|