C19H16Cl3N5O4S — CID 99944478
2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dichloro-4-nitrophenyl)acetamide (PubChem CID 99944478) has the molecular formula C19H16Cl3N5O4S and a molecular weight of 516.79 g/mol. Its IUPAC name is 2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dichloro-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dichloro-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 99944478 |
| Molecular Formula | C19H16Cl3N5O4S |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 515.00 |
| IUPAC Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-dichloro-4-nitrophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C19H16Cl3N5O4S/c1-3-26-18(12-6-10(20)4-5-15(12)31-2)24-25-19(26)32-9-16(28)23-17-13(21)7-11(27(29)30)8-14(17)22/h4-8H,3,9H2,1-2H3,(H,23,28) |
| InChIKey | RLVFKCAGXPTMKA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|