C23H22N6O5 — CID 137059184
N'-diazenyl-2-[[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)-4-oxo-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl]oxy]ethanimidamide (PubChem CID 137059184) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is N'-diazenyl-2-[[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)-4-oxo-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl]oxy]ethanimidamide.
| Compound Name | N'-diazenyl-2-[[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)-4-oxo-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl]oxy]ethanimidamide |
|---|---|
| PubChem CID | 137059184 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N'-diazenyl-2-[[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)-4-oxo-6,7-dihydropyrimido[6,1-a]isoquinolin-9-yl]oxy]ethanimidamide |
| SMILES | [H]/N=N/N=C(N)COc1ccc2c(c1)CCn1c-2cc(OCC2COc3ccccc3O2)nc1=O |
| InChI | InChI=1S/C23H22N6O5/c24-21(27-28-25)13-31-15-5-6-17-14(9-15)7-8-29-18(17)10-22(26-23(29)30)33-12-16-11-32-19-3-1-2-4-20(19)34-16/h1-6,9-10,16H,7-8,11-13H2,(H3,24,25,27) |
| InChIKey | VUBUZNPXEUABMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 146.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|