C10H18N4 — CID 137059244
(7Z)-N,N,8-trimethyl-2-methylimino-5,6-dihydro-1H-1,3-diazocin-4-amine (PubChem CID 137059244) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (7Z)-N,N,8-trimethyl-2-methylimino-5,6-dihydro-1H-1,3-diazocin-4-amine.
| Compound Name | (7Z)-N,N,8-trimethyl-2-methylimino-5,6-dihydro-1H-1,3-diazocin-4-amine |
|---|---|
| PubChem CID | 137059244 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (7Z)-N,N,8-trimethyl-2-methylimino-5,6-dihydro-1H-1,3-diazocin-4-amine |
| SMILES | C/N=C1\N=C(N(C)C)CC/C=C(/C)N1 |
| InChI | InChI=1S/C10H18N4/c1-8-6-5-7-9(14(3)4)13-10(11-2)12-8/h6H,5,7H2,1-4H3,(H,11,12)/b8-6-,13-9? |
| InChIKey | GKIJMCFAOCXELF-IOAGGNQZSA-N |
| XLogP | 1.22 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|