C14H25FN4 — CID 176528116
4-(2-fluoropropan-2-yl)-8-pentan-3-ylimino-6,7-dihydro-1H-1,3-diazocin-2-amine (PubChem CID 176528116) has the molecular formula C14H25FN4 and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-(2-fluoropropan-2-yl)-8-pentan-3-ylimino-6,7-dihydro-1H-1,3-diazocin-2-amine.
| Compound Name | 4-(2-fluoropropan-2-yl)-8-pentan-3-ylimino-6,7-dihydro-1H-1,3-diazocin-2-amine |
|---|---|
| PubChem CID | 176528116 |
| Molecular Formula | C14H25FN4 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 4-(2-fluoropropan-2-yl)-8-pentan-3-ylimino-6,7-dihydro-1H-1,3-diazocin-2-amine |
| SMILES | CCC(CC)/N=C1\CCC=C(C(C)(C)F)/N=C(/N)N1 |
| InChI | InChI=1S/C14H25FN4/c1-5-10(6-2)17-12-9-7-8-11(14(3,4)15)18-13(16)19-12/h8,10H,5-7,9H2,1-4H3,(H3,16,17,18,19) |
| InChIKey | JLJIQRYPCDUCIY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|