C21H22ClN9O — CID 137061056
N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-9-(furan-3-yl)-2-piperazin-1-yl-2,3-dihydro-1H-purin-6-imine (PubChem CID 137061056) has the molecular formula C21H22ClN9O and a molecular weight of 451.92 g/mol. Its IUPAC name is N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-9-(furan-3-yl)-2-piperazin-1-yl-2,3-dihydro-1H-purin-6-imine.
| Compound Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-9-(furan-3-yl)-2-piperazin-1-yl-2,3-dihydro-1H-purin-6-imine |
|---|---|
| PubChem CID | 137061056 |
| Molecular Formula | C21H22ClN9O |
| Molecular Weight | 451.92 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-9-(furan-3-yl)-2-piperazin-1-yl-2,3-dihydro-1H-purin-6-imine |
| SMILES | Clc1ccc2nc(C/N=C3\NC(N4CCNCC4)Nc4c3ncn4-c3ccoc3)[nH]c2c1 |
| InChI | InChI=1S/C21H22ClN9O/c22-13-1-2-15-16(9-13)27-17(26-15)10-24-19-18-20(31(12-25-18)14-3-8-32-11-14)29-21(28-19)30-6-4-23-5-7-30/h1-3,8-9,11-12,21,23,29H,4-7,10H2,(H,24,28)(H,26,27) |
| InChIKey | PJNDKVZPYMTONJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.92 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|