C13H17Cl2N3O — CID 137062636
2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 137062636) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 137062636 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/CC(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O/c1-8(2)6-17-13(16)18-7-11(19)12-9(14)4-3-5-10(12)15/h3-5,11,19H,1,6-7H2,2H3,(H3,16,17,18) |
| InChIKey | MRGOYNGVQFXJOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|