About 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine
2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 137062636) has the molecular formula C13H17Cl2N3O
and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine.
Molecular Properties
| Compound Name | 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine |
| PubChem CID | 137062636 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/CC(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O/c1-8(2)6-17-13(16)18-7-11(19)12-9(14)4-3-5-10(12)15/h3-5,11,19H,1,6-7H2,2H3,(H3,16,17,18) |
| InChIKey | MRGOYNGVQFXJOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine?
The IUPAC name of 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine (CID 137062636) is 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine.
What is the SMILES notation for 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine?
The canonical SMILES for 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine is C=C(C)CN/C(N)=N/CC(O)c1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine?
The InChIKey is MRGOYNGVQFXJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2N3O/c1-8(2)6-17-13(16)18-7-11(19)12-9(14)4-3-5-10(12)15/h3-5,11,19H,1,6-7H2,2H3,(H3,16,17,18).
What are the key properties of 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine?
2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine has a molecular weight of 302.21 g/mol, XLogP of 2.51, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-1-(2-methylprop-2-enyl)guanidine is sourced from PubChem (CID 137062636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).