C44H33N5S — CID 137067047
12-[3-(6-cyclohexa-1,5-dien-1-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-6-yl]-2-phenyl-[1]benzothiolo[2,3-a]carbazole (PubChem CID 137067047) has the molecular formula C44H33N5S and a molecular weight of 663.85 g/mol. Its IUPAC name is 12-[3-(6-cyclohexa-1,5-dien-1-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-6-yl]-2-phenyl-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[3-(6-cyclohexa-1,5-dien-1-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-6-yl]-2-phenyl-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 137067047 |
| Molecular Formula | C44H33N5S |
| Molecular Weight | 663.85 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 12-[3-(6-cyclohexa-1,5-dien-1-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-6-yl]-2-phenyl-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C1=CC(C2=NC(C3=CC=C(n4c5cc(-c6ccccc6)ccc5c5ccc6c7ccccc7sc6c54)NC3)=NC(c3ccccc3)N2)=CCC1 |
| InChI | InChI=1S/C44H33N5S/c1-4-12-28(13-5-1)31-20-22-33-35-23-24-36-34-18-10-11-19-38(34)50-41(36)40(35)49(37(33)26-31)39-25-21-32(27-45-39)44-47-42(29-14-6-2-7-15-29)46-43(48-44)30-16-8-3-9-17-30/h1-2,4-8,10-26,42,45H,3,9,27H2,(H,46,47,48) |
| InChIKey | OJWWKWHQMZIRRE-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.85 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |