C21H15N3O5S — CID 137068664
4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazol-2-one (PubChem CID 137068664) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 137068664 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-hydroxy-5-[(2-methylindol-3-ylidene)methyl]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazol-2-one |
| SMILES | CC1=Nc2ccccc2C1=Cc1sc(=O)n(CC(=O)c2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C21H15N3O5S/c1-12-16(15-4-2-3-5-17(15)22-12)10-19-20(26)23(21(27)30-19)11-18(25)13-6-8-14(9-7-13)24(28)29/h2-10,26H,11H2,1H3 |
| InChIKey | GUSTVDOKEKNCCW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|