C22H23N5O3S — CID 137068888
4-[5-(3,4-dihydroquinolin-3-yl)-11-oxa-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-8-yl]thiane 1,1-dioxide (PubChem CID 137068888) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[5-(3,4-dihydroquinolin-3-yl)-11-oxa-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-8-yl]thiane 1,1-dioxide.
| Compound Name | 4-[5-(3,4-dihydroquinolin-3-yl)-11-oxa-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-8-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 137068888 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[5-(3,4-dihydroquinolin-3-yl)-11-oxa-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-8-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc3c(C4C=Nc5ccccc5C4)cnn3c3c2COCN3)CC1 |
| InChI | InChI=1S/C22H23N5O3S/c28-31(29)7-5-14(6-8-31)20-18-12-30-13-24-21(18)27-22(26-20)17(11-25-27)16-9-15-3-1-2-4-19(15)23-10-16/h1-4,10-11,14,16,24H,5-9,12-13H2 |
| InChIKey | FBZWYVDNUWINLA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |