C25H26N6O2 — CID 137069242
N-[5-[6-[4-(N'-hydroxycarbamimidoyl)phenyl]imidazo[1,2-b]pyridazin-2-yl]-2-methylphenyl]-2,2-dimethylpropanamide (PubChem CID 137069242) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[5-[6-[4-(N'-hydroxycarbamimidoyl)phenyl]imidazo[1,2-b]pyridazin-2-yl]-2-methylphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[6-[4-(N'-hydroxycarbamimidoyl)phenyl]imidazo[1,2-b]pyridazin-2-yl]-2-methylphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 137069242 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[5-[6-[4-(N'-hydroxycarbamimidoyl)phenyl]imidazo[1,2-b]pyridazin-2-yl]-2-methylphenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(-c2cn3nc(-c4ccc(C(N)=NO)cc4)ccc3n2)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H26N6O2/c1-15-5-6-18(13-20(15)28-24(32)25(2,3)4)21-14-31-22(27-21)12-11-19(29-31)16-7-9-17(10-8-16)23(26)30-33/h5-14,33H,1-4H3,(H2,26,30)(H,28,32) |
| InChIKey | BVGQAAAFLWIAMN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|