C28H28N6O4 — CID 140586880
N-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 140586880) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 140586880 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | Cc1ccc(-c2cn3nc(NC(=O)c4cccc(/C=C/C(=O)NO)c4)ccc3n2)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H28N6O4/c1-17-8-10-19(15-21(17)30-27(37)28(2,3)4)22-16-34-24(29-22)12-11-23(32-34)31-26(36)20-7-5-6-18(14-20)9-13-25(35)33-38/h5-16,38H,1-4H3,(H,30,37)(H,33,35)(H,31,32,36)/b13-9+ |
| InChIKey | IWPBHNDTGSXPQL-UKTHLTGXSA-N |
| XLogP | 4.46 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|