C30H25F3N4O3 — CID 163841274
(E)-3-[3-[[2-methyl-5-[6-[(2Z,4Z)-1,1,1-trifluoro-2-methylhexa-2,4-dien-3-yl]imidazo[1,2-b]pyridazin-2-yl]phenyl]carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 163841274) has the molecular formula C30H25F3N4O3 and a molecular weight of 546.55 g/mol. Its IUPAC name is (E)-3-[3-[[2-methyl-5-[6-[(2Z,4Z)-1,1,1-trifluoro-2-methylhexa-2,4-dien-3-yl]imidazo[1,2-b]pyridazin-2-yl]phenyl]carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[2-methyl-5-[6-[(2Z,4Z)-1,1,1-trifluoro-2-methylhexa-2,4-dien-3-yl]imidazo[1,2-b]pyridazin-2-yl]phenyl]carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163841274 |
| Molecular Formula | C30H25F3N4O3 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | (E)-3-[3-[[2-methyl-5-[6-[(2Z,4Z)-1,1,1-trifluoro-2-methylhexa-2,4-dien-3-yl]imidazo[1,2-b]pyridazin-2-yl]phenyl]carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | C/C=C\C(=C(/C)C(F)(F)F)c1ccc2nc(-c3ccc(C)c(NC(=O)c4cccc(/C=C/C(=O)O)c4)c3)cn2n1 |
| InChI | InChI=1S/C30H25F3N4O3/c1-4-6-23(19(3)30(31,32)33)24-12-13-27-34-26(17-37(27)36-24)21-11-9-18(2)25(16-21)35-29(40)22-8-5-7-20(15-22)10-14-28(38)39/h4-17H,1-3H3,(H,35,40)(H,38,39)/b6-4-,14-10+,23-19- |
| InChIKey | OMFGJJHLOFPHLN-ILZGFURFSA-N |
| XLogP | 6.97 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|