C25H23F3N6O3 — CID 88541540
N'-hydroxy-N-[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]hexanediamide (PubChem CID 88541540) has the molecular formula C25H23F3N6O3 and a molecular weight of 512.49 g/mol. Its IUPAC name is N'-hydroxy-N-[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 88541540 |
| Molecular Formula | C25H23F3N6O3 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N'-hydroxy-N-[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]hexanediamide |
| SMILES | Cc1ccc(-c2cn3nc(-c4cccnc4C(F)(F)F)ccc3n2)cc1NC(=O)CCCCC(=O)NO |
| InChI | InChI=1S/C25H23F3N6O3/c1-15-8-9-16(13-19(15)31-22(35)6-2-3-7-23(36)33-37)20-14-34-21(30-20)11-10-18(32-34)17-5-4-12-29-24(17)25(26,27)28/h4-5,8-14,37H,2-3,6-7H2,1H3,(H,31,35)(H,33,36) |
| InChIKey | QHAZEOGNOLYARV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|