C31H34F3N5O4 — CID 57406710
6-[3-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-2-(trifluoromethyl)phenoxy]-N-hydroxyhexanamide (PubChem CID 57406710) has the molecular formula C31H34F3N5O4 and a molecular weight of 597.64 g/mol. Its IUPAC name is 6-[3-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-2-(trifluoromethyl)phenoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[3-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-2-(trifluoromethyl)phenoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 57406710 |
| Molecular Formula | C31H34F3N5O4 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 6-[3-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-2-(trifluoromethyl)phenoxy]-N-hydroxyhexanamide |
| SMILES | Cc1ccc(-c2cn3nc(-c4cccc(OCCCCCC(=O)NO)c4C(F)(F)F)ccc3n2)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H34F3N5O4/c1-19-12-13-20(17-23(19)36-29(41)30(2,3)4)24-18-39-26(35-24)15-14-22(37-39)21-9-8-10-25(28(21)31(32,33)34)43-16-7-5-6-11-27(40)38-42/h8-10,12-15,17-18,42H,5-7,11,16H2,1-4H3,(H,36,41)(H,38,40) |
| InChIKey | DAMZGFBCECZEFG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|